What is the molecular formula of Chembrdg-bb 4013120?
The molecular formula of Chembrdg-bb 4013120 is C11H24N2.
When was Chembrdg-bb 4013120 created?
Chembrdg-bb 4013120 was created on June 21, 2010.
What is the molecular weight of Chembrdg-bb 4013120?
The molecular weight of Chembrdg-bb 4013120 is 184.32 g/mol.
What is the IUPAC name of Chembrdg-bb 4013120?
The IUPAC name of Chembrdg-bb 4013120 is N-[2-(4-methylpiperidin-1-yl)ethyl]propan-2-amine.
What is the InChI of Chembrdg-bb 4013120?
The InChI of Chembrdg-bb 4013120 is InChI=1S/C11H24N2/c1-10(2)12-6-9-13-7-4-11(3)5-8-13/h10-12H,4-9H2,1-3H3.
What is the InChIKey of Chembrdg-bb 4013120?
The InChIKey of Chembrdg-bb 4013120 is HVMOOSAFNSNUMQ-UHFFFAOYSA-N.
What is the canonical SMILES of Chembrdg-bb 4013120?
The canonical SMILES of Chembrdg-bb 4013120 is CC1CCN(CC1)CCNC(C).
What is the CAS number of Chembrdg-bb 4013120?
The CAS number of Chembrdg-bb 4013120 is 915924-65-1.
What is the XLogP3-AA value of Chembrdg-bb 4013120?
The XLogP3-AA value of Chembrdg-bb 4013120 is 1.9.
Is Chembrdg-bb 4013120 a canonicalized compound?
Yes, Chembrdg-bb 4013120 is a canonicalized compound.