What is the molecular formula for Chembrdg-bb 4009639?
The molecular formula for Chembrdg-bb 4009639 is C10H22N2O.
When was Chembrdg-bb 4009639 created on PubChem?
Chembrdg-bb 4009639 was created on July 21, 2009.
What is the molecular weight of Chembrdg-bb 4009639?
The molecular weight of Chembrdg-bb 4009639 is 186.29 g/mol.
What is the IUPAC name of Chembrdg-bb 4009639?
The IUPAC name of Chembrdg-bb 4009639 is 1-[1-(2-methoxyethyl)piperidin-3-yl]-N-methylmethanamine.
What is the InChI code for Chembrdg-bb 4009639?
The InChI code for Chembrdg-bb 4009639 is InChI=1S/C10H22N2O/c1-11-8-10-4-3-5-12(9-10)6-7-13-2/h10-11H,3-9H2,1-2H3.
How many hydrogen bond donor counts does Chembrdg-bb 4009639 have?
Chembrdg-bb 4009639 has 1 hydrogen bond donor count.
What is the XLogP3-AA value of Chembrdg-bb 4009639?
The XLogP3-AA value of Chembrdg-bb 4009639 is 0.4.
How many rotatable bond counts does Chembrdg-bb 4009639 have?
Chembrdg-bb 4009639 has 5 rotatable bond counts.
What is the topological polar surface area of Chembrdg-bb 4009639?
The topological polar surface area of Chembrdg-bb 4009639 is 24.5 Ų.
Is Chembrdg-bb 4009639 the canonicalized compound?
Yes, Chembrdg-bb 4009639 is the canonicalized compound on PubChem.