What is the molecular formula of 1,2,3,4,7,9-Hexachlorodibenzofuran?
The molecular formula of 1,2,3,4,7,9-Hexachlorodibenzofuran is C12H2Cl6O.
What is the molecular weight of 1,2,3,4,7,9-Hexachlorodibenzofuran?
The molecular weight of 1,2,3,4,7,9-Hexachlorodibenzofuran is 374.9 g/mol.
When was 1,2,3,4,7,9-Hexachlorodibenzofuran created?
1,2,3,4,7,9-Hexachlorodibenzofuran was created on March 27, 2005.
When was 1,2,3,4,7,9-Hexachlorodibenzofuran last modified?
1,2,3,4,7,9-Hexachlorodibenzofuran was last modified on December 30, 2023.
What is the IUPAC name of 1,2,3,4,7,9-Hexachlorodibenzofuran?
The IUPAC name of 1,2,3,4,7,9-Hexachlorodibenzofuran is 1,2,3,4,7,9-hexachlorodibenzofuran.
What is the canonical SMILES of 1,2,3,4,7,9-Hexachlorodibenzofuran?
The canonical SMILES of 1,2,3,4,7,9-Hexachlorodibenzofuran is C1=C(C=C(C2=C1OC3=C2C(=C(C(=C3Cl)Cl)Cl)Cl)Cl)Cl.
What is the CAS number of 1,2,3,4,7,9-Hexachlorodibenzofuran?
The CAS number of 1,2,3,4,7,9-Hexachlorodibenzofuran is 91538-84-0.
How many hydrogen bond donor counts does 1,2,3,4,7,9-Hexachlorodibenzofuran have?
1,2,3,4,7,9-Hexachlorodibenzofuran has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 1,2,3,4,7,9-Hexachlorodibenzofuran have?
1,2,3,4,7,9-Hexachlorodibenzofuran has 1 hydrogen bond acceptor count.
What is the complexity value of 1,2,3,4,7,9-Hexachlorodibenzofuran?
The complexity value of 1,2,3,4,7,9-Hexachlorodibenzofuran is 355.