What is the molecular formula of 1,2,3,4,6,9-Hexachlorodibenzofuran?
The molecular formula of 1,2,3,4,6,9-Hexachlorodibenzofuran is C12H2Cl6O.
What is the molecular weight of 1,2,3,4,6,9-Hexachlorodibenzofuran?
The molecular weight of 1,2,3,4,6,9-Hexachlorodibenzofuran is 374.9 g/mol.
What is the IUPAC name of 1,2,3,4,6,9-Hexachlorodibenzofuran?
The IUPAC name of 1,2,3,4,6,9-Hexachlorodibenzofuran is 1,2,3,4,6,9-hexachlorodibenzofuran.
What is the InChI key of 1,2,3,4,6,9-Hexachlorodibenzofuran?
The InChI key of 1,2,3,4,6,9-Hexachlorodibenzofuran is KFFUZIROJGXTQH-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2,3,4,6,9-Hexachlorodibenzofuran?
The canonical SMILES of 1,2,3,4,6,9-Hexachlorodibenzofuran is C1=CC(=C2C(=C1Cl)C3=C(O2)C(=C(C(=C3Cl)Cl)Cl)Cl)Cl.
What is the CAS number of 1,2,3,4,6,9-Hexachlorodibenzofuran?
The CAS number of 1,2,3,4,6,9-Hexachlorodibenzofuran is 91538-83-9.
How many chlorine atoms are attached to the carbon atoms in 1,2,3,4,6,9-Hexachlorodibenzofuran?
There are six chlorine atoms attached to the carbon atoms in 1,2,3,4,6,9-Hexachlorodibenzofuran.
Is 1,2,3,4,6,9-Hexachlorodibenzofuran deliberately produced by industry?
No, 1,2,3,4,6,9-Hexachlorodibenzofuran is not deliberately produced by industry.
How many congeners does the CDF family contain?
The CDF family contains 135 congeners.
Are CDFs harmful to health and the environment?
Yes, CDFs can have harmful health and environmental effects, especially those that contain chlorine atoms at specific positions in the parent dibenzofuran molecule.
Download
![[(5-Bromopyridine-2-carbonyl)-amino]-acetic acid methyl ester](https://resource.alfa-chemistry.com/structure/915394-66-0.gif)
