What is the molecular formula of Napamezole?
The molecular formula of Napamezole is C14H16N2.
What is the molecular weight of Napamezole?
The molecular weight of Napamezole is 212.29 g/mol.
What is the IUPAC name of Napamezole?
The IUPAC name of Napamezole is 2-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole.
What is the InChIKey of Napamezole?
The InChIKey of Napamezole is WETRBJOSGIDJHQ-UHFFFAOYSA-N.
What is the canonical SMILES of Napamezole?
The canonical SMILES of Napamezole is C1CC(=CC2=CC=CC=C21)CC3=NCCN3.
What is the CAS number of Napamezole?
The CAS number of Napamezole is 91524-14-0.
What is the UNII of Napamezole?
The UNII of Napamezole is GK4C2D295B.
What is the ChEMBL ID of Napamezole?
The ChEMBL ID of Napamezole is CHEMBL167493.
What is the DSSTox Substance ID of Napamezole?
The DSSTox Substance ID of Napamezole is DTXSID30869081.
Is Napamezole a canonicalized compound?
Yes, Napamezole is a canonicalized compound according to PubChem.