What is the molecular formula of DL-tartaric-2,3-d2 acid?
The molecular formula of DL-tartaric-2,3-d2 acid is C4H6O6.
What is the molecular weight of DL-tartaric-2,3-d2 acid?
The molecular weight of DL-tartaric-2,3-d2 acid is 152.10 g/mol.
What is the IUPAC name of DL-tartaric-2,3-d2 acid?
The IUPAC name of DL-tartaric-2,3-d2 acid is 2,3-dideuterio-2,3-dihydroxybutanedioic acid.
What is the InChI of DL-tartaric-2,3-d2 acid?
The InChI of DL-tartaric-2,3-d2 acid is InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/i1D,2D.
What is the InChIKey of DL-tartaric-2,3-d2 acid?
The InChIKey of DL-tartaric-2,3-d2 acid is FEWJPZIEWOKRBE-QDNHWIQGSA-N.
What is the canonical SMILES of DL-tartaric-2,3-d2 acid?
The canonical SMILES of DL-tartaric-2,3-d2 acid is C(C(C(=O)O)O)(C(=O)O)O.
How many hydrogen bond donor counts does DL-tartaric-2,3-d2 acid have?
DL-tartaric-2,3-d2 acid has 4 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does DL-tartaric-2,3-d2 acid have?
DL-tartaric-2,3-d2 acid has 6 hydrogen bond acceptor counts.
How many rotatable bond counts does DL-tartaric-2,3-d2 acid have?
DL-tartaric-2,3-d2 acid has 3 rotatable bond counts.
What is the topological polar surface area of DL-tartaric-2,3-d2 acid?
The topological polar surface area of DL-tartaric-2,3-d2 acid is 115?2.