What is the molecular formula of Fmoc-L-2-amino-5-methylhex-4-enoic acid?
The molecular formula is C22H23NO4.
What is the molecular weight of Fmoc-L-2-amino-5-methylhex-4-enoic acid?
The molecular weight is 365.4 g/mol.
What is the IUPAC name of Fmoc-L-2-amino-5-methylhex-4-enoic acid?
The IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methylhex-4-enoic acid.
What is the InChI of Fmoc-L-2-amino-5-methylhex-4-enoic acid?
The InChI is InChI=1S/C22H23NO4/c1-14(2)11-12-20(21(24)25)23-22(26)27-13-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h3-11,19-20H,12-13H2,1-2H3,(H,23,26)(H,24,25)/t20-/m0/s1.
What is the InChIKey of Fmoc-L-2-amino-5-methylhex-4-enoic acid?
The InChIKey is GGOWOCDBQNURKM-FQEVSTJZSA-N.
What is the canonical SMILES of Fmoc-L-2-amino-5-methylhex-4-enoic acid?
The canonical SMILES is CC(=CCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C.
What is the isomeric SMILES of Fmoc-L-2-amino-5-methylhex-4-enoic acid?
The isomeric SMILES is CC(=CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C.
What is the XLogP3-AA value of Fmoc-L-2-amino-5-methylhex-4-enoic acid?
The XLogP3-AA value is 4.6.
How many hydrogen bond donor counts does Fmoc-L-2-amino-5-methylhex-4-enoic acid have?
Fmoc-L-2-amino-5-methylhex-4-enoic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Fmoc-L-2-amino-5-methylhex-4-enoic acid have?
Fmoc-L-2-amino-5-methylhex-4-enoic acid has 4 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.