What is the molecular formula of 1H-Indole-1-carboxylic acid, 3-formyl-6-methyl-, 1,1-dimethylethyl ester?
The molecular formula is C15H17NO3.
What are some synonyms for 1H-Indole-1-carboxylic acid, 3-formyl-6-methyl-, 1,1-dimethylethyl ester?
Some synonyms include 1-Boc-6-Methyl-3-formylindole, tert-butyl 3-formyl-6-methyl-1H-indole-1-carboxylate, and 6-METHYL-3-FORMYLINDOLE-1-CARBOXYLIC ACID TERT-BUTYL ESTER.
When was the molecule first created and when was it last modified?
The molecule was created on May 30, 2009, and last modified on December 30, 2023.
What is the IUPAC name of the molecule?
The IUPAC name is tert-butyl 3-formyl-6-methylindole-1-carboxylate.
What is the Canonical SMILES representation of the molecule?
The Canonical SMILES representation is CC1=CC2=C(C=C1)C(=CN2C(=O)OC(C)(C)C)C=O.
What is the InChIKey of the molecule?
The InChIKey is OMUFPIBMLHSVAQ-UHFFFAOYSA-N.
What is the exact mass of the molecule?
The exact mass is 259.12084340 g/mol.
How many hydrogen bond donors are present in the molecule?
There are 0 hydrogen bond donors in the molecule.
What is the XLogP3-AA value of the molecule?
The XLogP3-AA value is 3.1.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.