What is the molecular formula of 3-Chloronon-1-ene?
The molecular formula of 3-Chloronon-1-ene is C9H17Cl.
What is the molecular weight of 3-Chloronon-1-ene?
The molecular weight of 3-Chloronon-1-ene is 160.68 g/mol.
What is the IUPAC name of 3-Chloronon-1-ene?
The IUPAC name of 3-Chloronon-1-ene is 3-chloronon-1-ene.
What is the InChI of 3-Chloronon-1-ene?
The InChI of 3-Chloronon-1-ene is InChI=1S/C9H17Cl/c1-3-5-6-7-8-9(10)4-2/h4,9H,2-3,5-8H2,1H3.
What is the InChIKey of 3-Chloronon-1-ene?
The InChIKey of 3-Chloronon-1-ene is WQEMCADLIQDYOT-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Chloronon-1-ene?
The Canonical SMILES of 3-Chloronon-1-ene is CCCCCCC(C=C)Cl.
What is the XLogP3-AA value of 3-Chloronon-1-ene?
The XLogP3-AA value of 3-Chloronon-1-ene is 4.4.
How many rotatable bonds does 3-Chloronon-1-ene have?
3-Chloronon-1-ene has 6 rotatable bonds.
What is the topological polar surface area of 3-Chloronon-1-ene?
The topological polar surface area of 3-Chloronon-1-ene is 0-2.
Is 3-Chloronon-1-ene a canonicalized compound?
Yes, 3-Chloronon-1-ene is a canonicalized compound.