What is the molecular formula of 2-(tert-butoxycarbonyl)-3,5-dimethylbenzoic acid?
The molecular formula is C14H18O4.
What are the synonyms for 2-(tert-butoxycarbonyl)-3,5-dimethylbenzoic acid?
The synonyms are 914223-23-7, 3,5-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid, DTXSID90698314, and 2-(TERT-BUTOXYCARBONYL)-3,5-DIMETHYLBENZOICACID.
What is the molecular weight of 2-(tert-butoxycarbonyl)-3,5-dimethylbenzoic acid?
The molecular weight is 250.29 g/mol.
What is the IUPAC name of 2-(tert-butoxycarbonyl)-3,5-dimethylbenzoic acid?
The IUPAC name is 3,5-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid.
What is the InChI of 2-(tert-butoxycarbonyl)-3,5-dimethylbenzoic acid?
The InChI is InChI=1S/C14H18O4/c1-8-6-9(2)11(10(7-8)12(15)16)13(17)18-14(3,4)5/h6-7H,1-5H3,(H,15,16).
What is the InChIKey of 2-(tert-butoxycarbonyl)-3,5-dimethylbenzoic acid?
The InChIKey is VTEODHYJQGQWQB-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(tert-butoxycarbonyl)-3,5-dimethylbenzoic acid?
The canonical SMILES is CC1=CC(=C(C(=C1)C(=O)O)C(=O)OC(C)(C)C).
What is the CAS number of 2-(tert-butoxycarbonyl)-3,5-dimethylbenzoic acid?
The CAS number is 914223-23-7.
Is 2-(tert-butoxycarbonyl)-3,5-dimethylbenzoic acid a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.