What is the molecular formula of Depropylamino hydroxy propafenone?
The molecular formula of Depropylamino hydroxy propafenone is C18H20O4.
What is the molecular weight of Depropylamino hydroxy propafenone?
The molecular weight of Depropylamino hydroxy propafenone is 300.3 g/mol.
When was Depropylamino hydroxy propafenone created?
Depropylamino hydroxy propafenone was created on May 17, 2013.
What is the IUPAC name of Depropylamino hydroxy propafenone?
The IUPAC name of Depropylamino hydroxy propafenone is 1-[2-(2,3-dihydroxypropoxy)phenyl]-3-phenylpropan-1-one.
What is the InChI of Depropylamino hydroxy propafenone?
The InChI of Depropylamino hydroxy propafenone is: InChI=1S/C18H20O4/c19-12-15(20)13-22-18-9-5-4-8-16(18)17(21)11-10-14-6-2-1-3-7-14/h1-9,15,19-20H,10-13H2.
What is the InChIKey of Depropylamino hydroxy propafenone?
The InChIKey of Depropylamino hydroxy propafenone is KRSTZDUMPGTWJG-UHFFFAOYSA-N.
What is the canonical SMILES of Depropylamino hydroxy propafenone?
The canonical SMILES of Depropylamino hydroxy propafenone is C1=CC=C(C=C1)CCC(=O)C2=CC=CC=C2OCC(CO)O.
What is the CAS number of Depropylamino hydroxy propafenone?
The CAS number of Depropylamino hydroxy propafenone is 91401-73-9.
What is the UNII identifier of Depropylamino hydroxy propafenone?
The UNII identifier of Depropylamino hydroxy propafenone is G0R1CCR973.
What is the XLogP3-AA value of Depropylamino hydroxy propafenone?
The XLogP3-AA value of Depropylamino hydroxy propafenone is 2.2.
※ Please kindly note that our products are for research use only.