The molecular formula of the compound is C15H19NSi.
What are the synonyms of the compound?
The synonyms of the compound are SCHEMBL3199991, LUTFABDUDMRJDB-UHFFFAOYSA-N, 4-Methyl-2-(3-trimethylsilylphenyl)pyridine, and 4-Methyl-2-(3-trimethylsilanyl-phenyl)-pyridine.
What is the molecular weight of the compound?
The molecular weight of the compound is 241.40 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is trimethyl-[3-(4-methylpyridin-2-yl)phenyl]silane.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C15H19NSi/c1-12-8-9-16-15(10-12)13-6-5-7-14(11-13)17(2,3)4/h5-11H,1-4H3.
What is the InChIKey of the compound?
The InChIKey of the compound is LUTFABDUDMRJDB-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=CC(=NC=C1)C2=CC(=CC=C2)[Si](C)(C)C.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 0.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count of the compound is 1.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.
Download
![Oxazole,2-[(1S)-7'-(diphenylphosphino)-2,2',3,3'-tetrahydro-1,1'-spirobi[1h-inden]-7-yl]-4,5-dihydro-4-(phenylmethyl)-,(4S)-](https://resource.alfa-chemistry.com/structure/913829-88-6.gif)
![Oxazole,2-[(1S)-7'-[bis(3,5-dimethylphenyl)phosphino]-2,2',3,3'-tetrahydro-1,1'-spirobi[1h-inden]-7-yl]-4,5-dihydro-4-(phenylmethyl)-,(4S)-](https://resource.alfa-chemistry.com/structure/913829-90-0.gif)
