The molecular formula of the compound is C11H9FIN3.
What are the synonyms of the compound?
The synonyms of the compound are 913322-53-9, 4-METHYL-6-(2-IODO-5-FLUOROPHENYL)PYRIMIDIN-2-AMINE, 4-(5-fluoro-2-iodophenyl)-6-methylpyrimidin-2-amine, and DTXSID00699332.
What is the molecular weight of the compound?
The molecular weight of the compound is 329.11 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-(5-fluoro-2-iodophenyl)-6-methylpyrimidin-2-amine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H9FIN3/c1-6-4-10(16-11(14)15-6)8-5-7(12)2-3-9(8)13/h2-5H,1H3,(H2,14,15,16).
What is the InChIKey of the compound?
The InChIKey of the compound is SCMMMFJBUGMQRH-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CC1=CC(=NC(=N1)N)C2=C(C=CC(=C2)F)I.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.7.
How many hydrogen bond donor counts are there in the compound?
There is 1 hydrogen bond donor count in the compound.
How many hydrogen bond acceptor counts are there in the compound?
There are 4 hydrogen bond acceptor counts in the compound.
※ Please kindly note that our products are for research use only.