What is the molecular formula of Chembrdg-bb 9021407?
The molecular formula of Chembrdg-bb 9021407 is C8H11NO3S.
What is the molecular weight of Chembrdg-bb 9021407?
The molecular weight of Chembrdg-bb 9021407 is 201.25 g/mol.
When was Chembrdg-bb 9021407 created?
Chembrdg-bb 9021407 was created on 2006-04-29.
When was Chembrdg-bb 9021407 last modified?
Chembrdg-bb 9021407 was last modified on 2023-12-30.
What is the IUPAC Name of Chembrdg-bb 9021407?
The IUPAC Name of Chembrdg-bb 9021407 is N-(4-hydroxy-2-methylphenyl)methanesulfonamide.
What is the InChI of Chembrdg-bb 9021407?
The InChI of Chembrdg-bb 9021407 is InChI=1S/C8H11NO3S/c1-6-5-7(10)3-4-8(6)9-13(2,11)12/h3-5,9-10H,1-2H3.
What is the InChIKey of Chembrdg-bb 9021407?
The InChIKey of Chembrdg-bb 9021407 is LKNOILJFNZEBCH-UHFFFAOYSA-N.
What is the Canonical SMILES of Chembrdg-bb 9021407?
The Canonical SMILES of Chembrdg-bb 9021407 is CC1=C(C=CC(=C1)O)NS(=O)(=O)C.
What is the CAS number of Chembrdg-bb 9021407?
The CAS number of Chembrdg-bb 9021407 is 912895-74-0.
Is Chembrdg-bb 9021407 a canonicalized compound?
Yes, Chembrdg-bb 9021407 is a canonicalized compound.