What is the molecular formula of Ethyl 4-(2-methylimidazo[4,5-c]pyridin-1-yl)benzoate?
The molecular formula is C16H15N3O2.
What are the synonyms for Ethyl 4-(2-methylimidazo[4,5-c]pyridin-1-yl)benzoate?
The synonyms are 912773-06-9, Ethyl 4-(2-methyl-1H-imidazo[4,5-c]pyridin-1-yl)benzoate, ethyl 4-{2-methyl-1H-imidazo[4,5-c]pyridin-1-yl}benzoate, and DTXSID90723271.
When was Ethyl 4-(2-methylimidazo[4,5-c]pyridin-1-yl)benzoate created?
It was created on July 12, 2012.
When was Ethyl 4-(2-methylimidazo[4,5-c]pyridin-1-yl)benzoate last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of Ethyl 4-(2-methylimidazo[4,5-c]pyridin-1-yl)benzoate?
The IUPAC name is ethyl 4-(2-methylimidazo[4,5-c]pyridin-1-yl)benzoate.
What is the InChI of Ethyl 4-(2-methylimidazo[4,5-c]pyridin-1-yl)benzoate?
The InChI is InChI=1S/C16H15N3O2/c1-3-21-16(20)12-4-6-13(7-5-12)19-11(2)18-14-10-17-9-8-15(14)19/h4-10H,3H2,1-2H3.
What is the InChIKey of Ethyl 4-(2-methylimidazo[4,5-c]pyridin-1-yl)benzoate?
The InChIKey is UFJSXTUSACIAML-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 4-(2-methylimidazo[4,5-c]pyridin-1-yl)benzoate?
The canonical SMILES is CCOC(=O)C1=CC=C(C=C1)N2C(=NC3=C2C=CN=C3)C.
What is the molecular weight of Ethyl 4-(2-methylimidazo[4,5-c]pyridin-1-yl)benzoate?
The molecular weight is 281.31 g/mol.
What is the CAS number of Ethyl 4-(2-methylimidazo[4,5-c]pyridin-1-yl)benzoate?
The CAS number is 912773-06-9.
※ Please kindly note that our products are for research use only.