What is the molecular formula of [2-(Morpholinomethyl)phenyl]methanol?
The molecular formula is C12H17NO2.
What is the synonyms of [2-(Morpholinomethyl)phenyl]methanol?
The synonyms include 91271-63-5, [2-(morpholin-4-ylmethyl)phenyl]methanol, [2-(morpholinomethyl)phenyl]methanol, and {2-[(morpholin-4-yl)methyl]phenyl}methanol.
What is the molecular weight of [2-(Morpholinomethyl)phenyl]methanol?
The molecular weight is 207.27 g/mol.
What is the IUPAC name of [2-(Morpholinomethyl)phenyl]methanol?
The IUPAC name is [2-(morpholin-4-ylmethyl)phenyl]methanol.
What is the InChI of [2-(Morpholinomethyl)phenyl]methanol?
The InChI is InChI=1S/C12H17NO2/c14-10-12-4-2-1-3-11(12)9-13-5-7-15-8-6-13/h1-4,14H,5-10H2.
What is the InChIKey of [2-(Morpholinomethyl)phenyl]methanol?
The InChIKey is JOBIKMKNOFLXRQ-UHFFFAOYSA-N.
What is the canonical SMILES of [2-(Morpholinomethyl)phenyl]methanol?
The canonical SMILES is C1COCCN1CC2=CC=CC=C2CO.
What is the XLogP3 value of [2-(Morpholinomethyl)phenyl]methanol?
The XLogP3 value is 0.7.
What is the hydrogen bond donor count of [2-(Morpholinomethyl)phenyl]methanol?
The hydrogen bond donor count is 1.
What is the heavy atom count of [2-(Morpholinomethyl)phenyl]methanol?
The heavy atom count is 15.
※ Please kindly note that our products are for research use only.