What is the molecular formula of (R)-duloxetine hydrochloride?
The molecular formula of (R)-duloxetine hydrochloride is C18H20ClNOS.
What is the molecular weight of (R)-duloxetine hydrochloride?
The molecular weight of (R)-duloxetine hydrochloride is 333.9 g/mol.
What is the IUPAC Name of (R)-duloxetine hydrochloride?
The IUPAC Name of (R)-duloxetine hydrochloride is (3R)-N-methyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine; hydrochloride.
What is the chemical structure of (R)-duloxetine hydrochloride?
The chemical structure of (R)-duloxetine hydrochloride is CNCCC(C1=CC=CS1)OC2=CC=CC3=CC=CC=C32.Cl.
What are some synonyms for (R)-duloxetine hydrochloride?
Some synonyms for (R)-duloxetine hydrochloride include Duloxetine hydrochloride, (R)-, (-)-Duloxetine hydrochloride, and Duloxetine hydrochloride, (-)-.
What is the purpose of (R)-duloxetine hydrochloride?
(R)-duloxetine hydrochloride is a selective neurotransmitter uptake inhibitor used as an antidepressant, anxiolytic, and for the treatment of pain in patients with diabetes mellitus and fibromyalgia.
What is the InChIKey for (R)-duloxetine hydrochloride?
The InChIKey for (R)-duloxetine hydrochloride is BFFSMCNJSOPUAY-UNTBIKODSA-N.
What is the CAS number for (R)-duloxetine hydrochloride?
The CAS number for (R)-duloxetine hydrochloride is 910138-96-4.
How many hydrogen bond donor counts are there in (R)-duloxetine hydrochloride?
There are 2 hydrogen bond donor counts in (R)-duloxetine hydrochloride.
What is the topological polar surface area of (R)-duloxetine hydrochloride?
The topological polar surface area of (R)-duloxetine hydrochloride is 49.5 Å2.
※ Please kindly note that our products are for research use only.