What is the PubChem CID for 3-Tolyl diethanolamine?
The PubChem CID for 3-Tolyl diethanolamine is 7073.
What is the molecular formula of 3-Tolyl diethanolamine?
The molecular formula of 3-Tolyl diethanolamine is C11H17NO2.
What is the molecular weight of 3-Tolyl diethanolamine?
The molecular weight of 3-Tolyl diethanolamine is 195.26 g/mol.
What is the IUPAC name of 3-Tolyl diethanolamine?
The IUPAC name of 3-Tolyl diethanolamine is 2-[N-(2-hydroxyethyl)-3-methylanilino]ethanol.
What is the InChI (International Chemical Identifier) of 3-Tolyl diethanolamine?
The InChI of 3-Tolyl diethanolamine is InChI=1S/C11H17NO2/c1-10-3-2-4-11(9-10)12(5-7-13)6-8-14/h2-4,9,13-14H,5-8H2,1H3.
What is the InChIKey of 3-Tolyl diethanolamine?
The InChIKey of 3-Tolyl diethanolamine is VMNDRLYLEVCGAG-UHFFFAOYSA-N.
What is the canonical SMILES (Simplified Molecular Input Line Entry System) representation of 3-Tolyl diethanolamine?
The canonical SMILES representation of 3-Tolyl diethanolamine is CC1=CC(=CC=C1)N(CCO)CCO.
What is the CAS (Chemical Abstracts Service) number of 3-Tolyl diethanolamine?
The CAS number of 3-Tolyl diethanolamine is 91-99-6.
What is the XLogP3 value of 3-Tolyl diethanolamine?
The XLogP3 value of 3-Tolyl diethanolamine is 1.4.
What is the hydrogen bond donor count of 3-Tolyl diethanolamine?
The hydrogen bond donor count of 3-Tolyl diethanolamine is 2.