What is the molecular formula of Azoic Coupling Component 3?
The molecular formula of Azoic Coupling Component 3 is C36H28N2O6.
What is the molecular weight of Azoic Coupling Component 3?
The molecular weight of Azoic Coupling Component 3 is 584.6 g/mol.
What is the IUPAC name of Azoic Coupling Component 3?
The IUPAC name of Azoic Coupling Component 3 is 3-hydroxy-N-[4-[4-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-methoxyphenyl]-2-methoxyphenyl]naphthalene-2-carboxamide.
What is the InChI of Azoic Coupling Component 3?
The InChI of Azoic Coupling Component 3 is InChI=1S/C36H28N2O6/c1-43-33-19-25(11-13-29(33)37-35(41)27-15-21-7-3-5-9-23(21)17-31(27)39)26-12-14-30(34(20-26)44-2)38-36(42)28-16-22-8-4-6-10-24(22)18-32(28)40/h3-20,39-40H,1-2H3,(H,37,41)(H,38,42).
What is the InChIKey of Azoic Coupling Component 3?
The InChIKey of Azoic Coupling Component 3 is AXUHYNGMYQMRRI-UHFFFAOYSA-N.
What is the canonical SMILES of Azoic Coupling Component 3?
The canonical SMILES of Azoic Coupling Component 3 is COC1=C(C=CC(=C1)C2=CC(=C(C=C2)NC(=O)C3=CC4=CC=CC=C4C=C3O)OC)NC(=O)C5=CC6=CC=CC=C6C=C5O.
What is the CAS number of Azoic Coupling Component 3?
The CAS number of Azoic Coupling Component 3 is 91-92-9.
What is the XLogP3-AA value of Azoic Coupling Component 3?
The XLogP3-AA value of Azoic Coupling Component 3 is 8.1.
How many hydrogen bond donor counts are there in Azoic Coupling Component 3?
There are 4 hydrogen bond donor counts in Azoic Coupling Component 3.
How many rotatable bond counts are there in Azoic Coupling Component 3?
There are 7 rotatable bond counts in Azoic Coupling Component 3.
※ Please kindly note that our products are for research use only.