What is the molecular formula of Antazoline?
The molecular formula of Antazoline is C17H19N3.
What is the molecular weight of Antazoline?
The molecular weight of Antazoline is 265.35 g/mol.
What class does Antazoline belong to?
Antazoline is a member of the class of imidazolines.
What role does Antazoline play in the body?
Antazoline has a role as a H1-receptor antagonist, a cholinergic antagonist, and a xenobiotic.
How is Antazoline used in relieving symptoms?
Antazoline is used to provide symptomatic relief of allergic symptoms by antagonizing histamine H1 receptor.
What is the IUPAC name of Antazoline?
The IUPAC name of Antazoline is N-benzyl-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline.
What is the InChIKey of Antazoline?
The InChIKey of Antazoline is REYFJDPCWQRWAA-UHFFFAOYSA-N.
What is the Canonical SMILES of Antazoline?
The Canonical SMILES of Antazoline is C1CN=C(N1)CN(CC2=CC=CC=C2)C3=CC=CC=C3.
What is the CAS number of Antazoline?
The CAS number of Antazoline is 91-75-8.
What is the XLogP3-AA value of Antazoline?
The XLogP3-AA value of Antazoline is 2.6.