What is the molecular formula of N,N-Dibenzylaniline?
The molecular formula of N,N-Dibenzylaniline is C20H19N.
What is the molecular weight of N,N-Dibenzylaniline?
The molecular weight of N,N-Dibenzylaniline is 273.4 g/mol.
What is the IUPAC name of N,N-Dibenzylaniline?
The IUPAC name of N,N-Dibenzylaniline is N,N-dibenzylaniline.
What is the InChI of N,N-Dibenzylaniline?
The InChI of N,N-Dibenzylaniline is InChI=1S/C20H19N/c1-4-10-18(11-5-1)16-21(20-14-8-3-9-15-20)17-19-12-6-2-7-13-19/h1-15H,16-17H2.
What is the InChIKey of N,N-Dibenzylaniline?
The InChIKey of N,N-Dibenzylaniline is ISGXOWLMGOPVPB-UHFFFAOYSA-N.
What is the canonical SMILES of N,N-Dibenzylaniline?
The canonical SMILES of N,N-Dibenzylaniline is C1=CC=C(C=C1)CN(CC2=CC=CC=C2)C3=CC=CC=C3.
What is the CAS number of N,N-Dibenzylaniline?
The CAS number of N,N-Dibenzylaniline is 91-73-6.
What is the XLogP3 value of N,N-Dibenzylaniline?
The XLogP3 value of N,N-Dibenzylaniline is 5.7.
How many hydrogen bond donor count does N,N-Dibenzylaniline have?
N,N-Dibenzylaniline has 0 hydrogen bond donor count.
How many rotatable bond count does N,N-Dibenzylaniline have?
N,N-Dibenzylaniline has 5 rotatable bond count.