The molecular formula of the compound is C14H10ClNO6S.
What is the molecular weight of the compound?
The molecular weight of the compound is 355.8 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-[(2-carboxyphenyl)sulfamoyl]-2-chlorobenzoic acid.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C14H10ClNO6S/c15-11-6-5-8(7-10(11)14(19)20)23(21,22)16-12-4-2-1-3-9(12)13(17)18/h1-7,16H,(H,17,18)(H,19,20).
What is the InChIKey of the compound?
The InChIKey of the compound is XYUBQRPKIVSWKI-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC=C(C(=C1)C(=O)O)NS(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O.
What is the CAS number of the compound?
The CAS number of the compound is 91-36-1.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 202-064-7.
What is the UNII of the compound?
The UNII of the compound is GG4YX75MUN.
※ Please kindly note that our products are for research use only.