What is the molecular formula of 4-Bromo-dl-phenylalanine?
The molecular formula of 4-Bromo-dl-phenylalanine is C9H10BrNO2.
What is the molecular weight of 4-Bromo-dl-phenylalanine?
The molecular weight of 4-Bromo-dl-phenylalanine is 244.08 g/mol.
What is the IUPAC name of 4-Bromo-dl-phenylalanine?
The IUPAC name of 4-Bromo-dl-phenylalanine is 2-amino-3-(4-bromophenyl)propanoic acid.
What is the InChI of 4-Bromo-dl-phenylalanine?
The InChI of 4-Bromo-dl-phenylalanine is InChI=1S/C9H10BrNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13).
What is the InChIKey of 4-Bromo-dl-phenylalanine?
The InChIKey of 4-Bromo-dl-phenylalanine is PEMUHKUIQHFMTH-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-dl-phenylalanine?
The canonical SMILES of 4-Bromo-dl-phenylalanine is C1=CC(=CC=C1CC(C(=O)O)N)Br.
What is the CAS number of 4-Bromo-dl-phenylalanine?
The CAS number of 4-Bromo-dl-phenylalanine is 14091-15-7.
What is the XLogP3 value of 4-Bromo-dl-phenylalanine?
The XLogP3 value of 4-Bromo-dl-phenylalanine is -0.4.
How many hydrogen bond donor counts does 4-Bromo-dl-phenylalanine have?
4-Bromo-dl-phenylalanine has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Bromo-dl-phenylalanine have?
4-Bromo-dl-phenylalanine has 3 hydrogen bond acceptor counts.
Download
