What is the molecular formula of 2,6-Dimethoxy Phenol?
The molecular formula of 2,6-Dimethoxy Phenol is C8H10O3.
What is the molecular weight of 2,6-Dimethoxy Phenol?
The molecular weight of 2,6-Dimethoxy Phenol is 154.16 g/mol.
What are some synonyms for 2,6-Dimethoxy Phenol?
Some synonyms for 2,6-Dimethoxy Phenol are Syringol, Pyrogallol, and 1,3-dimethyl ether.
What is the IUPAC name of 2,6-Dimethoxy Phenol?
The IUPAC name of 2,6-Dimethoxy Phenol is 2,6-dimethoxyphenol.
What is the InChI of 2,6-Dimethoxy Phenol?
The InChI of 2,6-Dimethoxy Phenol is InChI=1S/C8H10O3/c1-10-6-4-3-5-7(11-2)8(6)9/h3-5,9H,1-2H3.
What is the InChIKey of 2,6-Dimethoxy Phenol?
The InChIKey of 2,6-Dimethoxy Phenol is KLIDCXVFHGNTTM-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Dimethoxy Phenol?
The canonical SMILES of 2,6-Dimethoxy Phenol is COC1=C(C(=CC=C1)OC)O.
What is the CAS number of 2,6-Dimethoxy Phenol?
The CAS number of 2,6-Dimethoxy Phenol is 91-10-1.
Where can 2,6-Dimethoxy Phenol be found in nature?
2,6-Dimethoxy Phenol can be found in Bistorta manshuriensis, Mucuna birdwoodiana, and other organisms with available data.
What is the XLogP3 value of 2,6-Dimethoxy Phenol?
The XLogP3 value of 2,6-Dimethoxy Phenol is 1.1.