What is the molecular formula of Chembrdg-bb 9005458?
The molecular formula of Chembrdg-bb 9005458 is C11H13N3O2.
What is the molecular weight of Chembrdg-bb 9005458?
The molecular weight of Chembrdg-bb 9005458 is 219.24 g/mol.
When was Chembrdg-bb 9005458 created?
Chembrdg-bb 9005458 was created on July 9, 2005.
What is the IUPAC name of Chembrdg-bb 9005458?
The IUPAC name of Chembrdg-bb 9005458 is 4-(2,4-dimethoxyphenyl)-1H-pyrazol-5-amine.
What is the InChIKey of Chembrdg-bb 9005458?
The InChIKey of Chembrdg-bb 9005458 is WGLXODMFXVOPHS-UHFFFAOYSA-N.
What is the canonical SMILES of Chembrdg-bb 9005458?
The canonical SMILES of Chembrdg-bb 9005458 is COC1=CC(=C(C=C1)C2=C(NN=C2)N)OC.
What is the CAS number of Chembrdg-bb 9005458?
The CAS number of Chembrdg-bb 9005458 is 909858-12-4.
What is the ChEMBL ID of Chembrdg-bb 9005458?
The ChEMBL ID of Chembrdg-bb 9005458 is CHEMBL1441773.
What is the XLogP3-AA value of Chembrdg-bb 9005458?
The XLogP3-AA value of Chembrdg-bb 9005458 is 1.4.
Is Chembrdg-bb 9005458 a canonicalized compound?
Yes, Chembrdg-bb 9005458 is a canonicalized compound.