What is the molecular formula of Peakdale 1013057?
The molecular formula of Peakdale 1013057 is C21H24F3N3O2.
When was Peakdale 1013057 created and last modified?
Peakdale 1013057 was created on 2008-02-29 and last modified on 2023-12-30.
What is the IUPAC Name of Peakdale 1013057?
The IUPAC Name of Peakdale 1013057 is methyl 4-[[4-[[6-(trifluoromethyl)pyridin-3-yl]methylamino]piperidin-1-yl]methyl]benzoate.
What is the Canonical SMILES of Peakdale 1013057?
The Canonical SMILES of Peakdale 1013057 is COC(=O)C1=CC=C(C=C1)CN2CCC(CC2)NCC3=CN=C(C=C3)C(F)(F)F.
What is the InChIKey of Peakdale 1013057?
The InChIKey of Peakdale 1013057 is WLXSDYYXAMTTJF-UHFFFAOYSA-N.
What is the molecular weight of Peakdale 1013057?
The molecular weight of Peakdale 1013057 is 407.4 g/mol.
How many hydrogen bond donor counts does Peakdale 1013057 have?
Peakdale 1013057 has 1 hydrogen bond donor count.
What is the Rotatable Bond Count of Peakdale 1013057?
The Rotatable Bond Count of Peakdale 1013057 is 7.
What is the Topological Polar Surface Area of Peakdale 1013057?
The Topological Polar Surface Area of Peakdale 1013057 is 54.5 Ų.
Is the Compound of Peakdale 1013057 canonicalized?
Yes, the Compound of Peakdale 1013057 is canonicalized.