What is the molecular formula of 6,7-Bis-(benzyloxy)coumarin?
The molecular formula of 6,7-Bis-(benzyloxy)coumarin is C23H18O4.
What is the molecular weight of 6,7-Bis-(benzyloxy)coumarin?
The molecular weight of 6,7-Bis-(benzyloxy)coumarin is 358.4 g/mol.
What is the IUPAC name of 6,7-Bis-(benzyloxy)coumarin?
The IUPAC name of 6,7-Bis-(benzyloxy)coumarin is 6,7-bis(phenylmethoxy)chromen-2-one.
What is the InChI of 6,7-Bis-(benzyloxy)coumarin?
The InChI of 6,7-Bis-(benzyloxy)coumarin is InChI=1S/C23H18O4/c24-23-12-11-19-13-21(25-15-17-7-3-1-4-8-17)22(14-20(19)27-23)26-16-18-9-5-2-6-10-18/h1-14H,15-16H2.
What is the InChIKey of 6,7-Bis-(benzyloxy)coumarin?
The InChIKey of 6,7-Bis-(benzyloxy)coumarin is GTUPSBQDBMSQTH-UHFFFAOYSA-N.
What is the canonical SMILES of 6,7-Bis-(benzyloxy)coumarin?
The canonical SMILES of 6,7-Bis-(benzyloxy)coumarin is C1=CC=C(C=C1)COC2=C(C=C3C(=C2)C=CC(=O)O3)OCC4=CC=CC=C4.
What is the CAS number of 6,7-Bis-(benzyloxy)coumarin?
The CAS number of 6,7-Bis-(benzyloxy)coumarin is 909-84-2.
What is the EC number of 6,7-Bis-(benzyloxy)coumarin?
The EC number of 6,7-Bis-(benzyloxy)coumarin is 213-003-9.
What is the UNII of 6,7-Bis-(benzyloxy)coumarin?
The UNII of 6,7-Bis-(benzyloxy)coumarin is A6DJ7GXA5B.
Is 6,7-Bis-(benzyloxy)coumarin a canonicalized compound?
Yes, 6,7-Bis-(benzyloxy)coumarin is a canonicalized compound.
※ Please kindly note that our products are for research use only.