What is the PubChem CID of L-(+)Homophenylalanine ethyl ester hydrochloride?
The PubChem CID of L-(+)Homophenylalanine ethyl ester hydrochloride is 71774793.
What is the molecular formula of L-(+)Homophenylalanine ethyl ester hydrochloride?
The molecular formula of L-(+)Homophenylalanine ethyl ester hydrochloride is C12H18ClNO2.
What is the synonym for L-(+)Homophenylalanine ethyl ester hydrochloride?
The synonym for L-(+)Homophenylalanine ethyl ester hydrochloride is FT-0627601.
What is the molecular weight of L-(+)Homophenylalanine ethyl ester hydrochloride?
The molecular weight of L-(+)Homophenylalanine ethyl ester hydrochloride is 243.73 g/mol.
What is the parent compound of L-(+)Homophenylalanine ethyl ester hydrochloride?
The parent compound of L-(+)Homophenylalanine ethyl ester hydrochloride is 2-(Ethylamino)-4-phenylbutanoic acid (CID 62880424).
What are the component compounds of L-(+)Homophenylalanine ethyl ester hydrochloride?
The component compounds of L-(+)Homophenylalanine ethyl ester hydrochloride are Hydrochloric Acid (CID 313) and 2-(Ethylamino)-4-phenylbutanoic acid (CID 62880424).
What is the IUPAC name of L-(+)Homophenylalanine ethyl ester hydrochloride?
The IUPAC name of L-(+)Homophenylalanine ethyl ester hydrochloride is 2-(ethylamino)-4-phenylbutanoic acid; hydrochloride.
What is the InChI of L-(+)Homophenylalanine ethyl ester hydrochloride?
The InChI of L-(+)Homophenylalanine ethyl ester hydrochloride is InChI=1S/C12H17NO2.ClH/c1-2-13-11(12(14)15)9-8-10-6-4-3-5-7-10;/h3-7,11,13H,2,8-9H2,1H3,(H,14,15);1H.
What is the InChIKey of L-(+)Homophenylalanine ethyl ester hydrochloride?
The InChIKey of L-(+)Homophenylalanine ethyl ester hydrochloride is BAULWXQXAOOQEL-UHFFFAOYSA-N.
What is the canonical SMILES of L-(+)Homophenylalanine ethyl ester hydrochloride?
The canonical SMILES of L-(+)Homophenylalanine ethyl ester hydrochloride is CCNC(CCC1=CC=CC=C1)C(=O)O.Cl.
※ Please kindly note that our products are for research use only.