What is the PubChem CID of Trecadrine?
The PubChem CID of Trecadrine is 65823.
What is the molecular formula of Trecadrine?
The molecular formula of Trecadrine is C27H29NO.
When was Trecadrine created?
Trecadrine was created on August 8, 2005.
When was Trecadrine last modified?
Trecadrine was last modified on December 30, 2023.
What is the IUPAC name of Trecadrine?
The IUPAC name of Trecadrine is 2-[methyl-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)ethyl]amino]-1-phenylpropan-1-ol.
What is the InChI of Trecadrine?
The InChI of Trecadrine is InChI=1S/C27H29NO/c1-20(27(29)23-12-4-3-5-13-23)28(2)19-18-26-24-14-8-6-10-21(24)16-17-22-11-7-9-15-25(22)26/h3-15,18,20,27,29H,16-17,19H2,1-2H3.
What is the InChIKey of Trecadrine?
The InChIKey of Trecadrine is BHVGOYREXHCFOE-UHFFFAOYSA-N.
What is the canonical SMILES of Trecadrine?
The canonical SMILES of Trecadrine is CC(C(C1=CC=CC=C1)O)N(C)CC=C2C3=CC=CC=C3CCC4=CC=CC=C42.
What is the molecular weight of Trecadrine?
The molecular weight of Trecadrine is 383.5 g/mol.
Is Trecadrine a canonicalized compound?
Yes, Trecadrine is a canonicalized compound according to PubChem.