What is the molecular formula of Tropine-3-xanthate?
The molecular formula of Tropine-3-xanthate is C9H15NOS2.
What are the synonyms of Tropine-3-xanthate?
The synonyms of Tropine-3-xanthate are JHJDYZOSHFQHMT-DHBOJHSNSA-N.
What is the molecular weight of Tropine-3-xanthate?
The molecular weight of Tropine-3-xanthate is 217.4 g/mol.
When was Tropine-3-xanthate created?
Tropine-3-xanthate was created on November 13, 2013.
When was Tropine-3-xanthate last modified?
Tropine-3-xanthate was last modified on December 30, 2023.
What is the IUPAC name of Tropine-3-xanthate?
The IUPAC name of Tropine-3-xanthate is [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanylmethanethioic S-acid.
What is the InChI of Tropine-3-xanthate?
The InChI of Tropine-3-xanthate is InChI=1S/C9H15NOS2/c1-10-6-2-3-7(10)5-8(4-6)13-9(11)12/h6-8H,2-5H2,1H3,(H,11,12)/t6-,7+,8?
What is the InChIKey of Tropine-3-xanthate?
The InChIKey of Tropine-3-xanthate is JHJDYZOSHFQHMT-DHBOJHSNSA-N.
What is the Canonical SMILES of Tropine-3-xanthate?
The Canonical SMILES of Tropine-3-xanthate is CN1C2CCC1CC(C2)SC(=O)S.
What is the Isomeric SMILES of Tropine-3-xanthate?
The Isomeric SMILES of Tropine-3-xanthate is CN1[C@@H]2CC[C@H]1CC(C2)SC(=O)S.