What is the molecular formula of 4-Cyanobutyrophenone?
The molecular formula of 4-Cyanobutyrophenone is C11H11NO.
When was 4-Cyanobutyrophenone created and last modified?
4-Cyanobutyrophenone was created on March 26, 2005, and last modified on December 30, 2023.
What is the IUPAC name of 4-Cyanobutyrophenone?
The IUPAC name of 4-Cyanobutyrophenone is 5-oxo-5-phenylpentanenitrile.
What is the molecular weight of 4-Cyanobutyrophenone?
The molecular weight of 4-Cyanobutyrophenone is 173.21 g/mol.
What is the Canonical SMILES notation of 4-Cyanobutyrophenone?
The Canonical SMILES notation of 4-Cyanobutyrophenone is C1=CC=C(C=C1)C(=O)CCCC#N.
What is the CAS number of 4-Cyanobutyrophenone?
The CAS number of 4-Cyanobutyrophenone is 10413-00-0.
How many hydrogen bond donor counts does 4-Cyanobutyrophenone have?
4-Cyanobutyrophenone has 0 hydrogen bond donor counts.
How many rotatable bond counts does 4-Cyanobutyrophenone have?
4-Cyanobutyrophenone has 4 rotatable bond counts.
What is the exact mass of 4-Cyanobutyrophenone?
The exact mass of 4-Cyanobutyrophenone is 173.084063974 g/mol.
Is the compound canonicalized for 4-Cyanobutyrophenone?
Yes, the compound is canonicalized for 4-Cyanobutyrophenone.