What is the molecular formula of ASISCHEM R03296?
The molecular formula of ASISCHEM R03296 is C9H14ClNO.
What is the molecular weight of ASISCHEM R03296?
The molecular weight of ASISCHEM R03296 is 187.66 g/mol.
What is the IUPAC name of ASISCHEM R03296?
The IUPAC name of ASISCHEM R03296 is N-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-2-chloroacetamide.
What is the InChI of ASISCHEM R03296?
The InChI of ASISCHEM R03296 is InChI=1S/C9H14ClNO/c10-5-9(12)11-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2,(H,11,12)/t6-,7+,8?/m1/s1.
What is the InChIKey of ASISCHEM R03296?
The InChIKey of ASISCHEM R03296 is ANWMKVWXYLYWNJ-KVARREAHSA-N.
What is the canonical SMILES of ASISCHEM R03296?
The canonical SMILES of ASISCHEM R03296 is C1CC2CC1CC2NC(=O)CCl.
What is the isomeric SMILES of ASISCHEM R03296?
The isomeric SMILES of ASISCHEM R03296 is C1C[C@H]2C[C@@H]1CC2NC(=O)CCl.
What is the XLogP3-AA value of ASISCHEM R03296?
The XLogP3-AA value of ASISCHEM R03296 is 1.9.
What is the hydrogen bond donor count of ASISCHEM R03296?
The hydrogen bond donor count of ASISCHEM R03296 is 1.
What is the hydrogen bond acceptor count of ASISCHEM R03296?
The hydrogen bond acceptor count of ASISCHEM R03296 is 1.