What is the molecular formula of the keyword compound?
The molecular formula of the keyword compound is C12H10O4.
What are the synonyms of the keyword compound?
The synonyms of the keyword compound include 906366-79-8, (2E)-2-[(3,4-Dihydroxyphenyl)methylene]-5-methyl-3(2H)-furanone, AKOS025295900, A843600, and more.
What is the molecular weight of the keyword compound?
The molecular weight of the keyword compound is 218.20 g/mol.
When was the keyword compound created?
The keyword compound was created on May 28, 2009.
When was the keyword compound last modified?
The keyword compound was last modified on October 21, 2023.
What is the IUPAC name of the keyword compound?
The IUPAC name of the keyword compound is (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-5-methylfuran-3-one.
What is the InChI of the keyword compound?
The InChI of the keyword compound is InChI=1S/C12H10O4/c1-7-4-11(15)12(16-7)6-8-2-3-9(13)10(14)5-8/h2-6,13-14H,1H3/b12-6+.
What is the InChIKey of the keyword compound?
The InChIKey of the keyword compound is NLZQGBCUKNUDED-WUXMJOGZSA-N.
What is the canonical SMILES of the keyword compound?
The canonical SMILES of the keyword compound is CC1=CC(=O)C(=CC2=CC(=C(C=C2)O)O)O1.
What is the CAS number of the keyword compound?
The CAS number of the keyword compound is 906366-79-8.
※ Please kindly note that our products are for research use only.