What is the molecular formula of Methyl 2-amino-5-(methylsulfonyl)benzoate?
The molecular formula is C9H11NO4S.
What are the synonyms for Methyl 2-amino-5-(methylsulfonyl)benzoate?
The synonyms are Methyl 2-amino-5-(methylsulfonyl)benzoate, 90610-65-4, methyl 2-amino-5-methylsulfonylbenzoate, MFCD12159812, and methyl 2-amino-5-methanesulfonylbenzoate.
What is the molecular weight of Methyl 2-amino-5-(methylsulfonyl)benzoate?
The molecular weight is 229.26 g/mol.
What is the IUPAC name of Methyl 2-amino-5-(methylsulfonyl)benzoate?
The IUPAC name is methyl 2-amino-5-methylsulfonylbenzoate.
What is the InChI of Methyl 2-amino-5-(methylsulfonyl)benzoate?
The InChI is InChI=1S/C9H11NO4S/c1-14-9(11)7-5-6(15(2,12)13)3-4-8(7)10/h3-5H,10H2,1-2H3.
What is the InChIKey of Methyl 2-amino-5-(methylsulfonyl)benzoate?
The InChIKey is DAJZKEMUMLYMDA-UHFFFAOYSA-N.
What is the canonical SMILES of Methyl 2-amino-5-(methylsulfonyl)benzoate?
The canonical SMILES is COC(=O)C1=C(C=CC(=C1)S(=O)(=O)C)N.
What is the CAS number of Methyl 2-amino-5-(methylsulfonyl)benzoate?
The CAS number is 90610-65-4.
Is Methyl 2-amino-5-(methylsulfonyl)benzoate a covalently-bonded unit?
Yes, it is a covalently-bonded unit.
※ Please kindly note that our products are for research use only.