What is the molecular formula of Deshydroxy bicalutamide?
The molecular formula of Deshydroxy bicalutamide is C18H14F4N2O3S.
What is the molecular weight of Deshydroxy bicalutamide?
The molecular weight of Deshydroxy bicalutamide is 414.4 g/mol.
What is the IUPAC name of Deshydroxy bicalutamide?
The IUPAC name of Deshydroxy bicalutamide is N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluorophenyl)sulfonyl-2-methylpropanamide.
What is the InChIKey of Deshydroxy bicalutamide?
The InChIKey of Deshydroxy bicalutamide is CLQOAZDMLVMGKV-UHFFFAOYSA-N.
What is the Canonical SMILES of Deshydroxy bicalutamide?
The Canonical SMILES of Deshydroxy bicalutamide is CC(CS(=O)(=O)C1=CC=C(C=C1)F)C(=O)NC2=CC(=C(C=C2)C#N)C(F)(F)F.
How many hydrogen bond donor counts does Deshydroxy bicalutamide have?
Deshydroxy bicalutamide has 1 hydrogen bond donor count.
What is the topological polar surface area of Deshydroxy bicalutamide?
The topological polar surface area of Deshydroxy bicalutamide is 95.4 Ų.
How many rotatable bond counts does Deshydroxy bicalutamide have?
Deshydroxy bicalutamide has 5 rotatable bond counts.
What is the formal charge of Deshydroxy bicalutamide?
The formal charge of Deshydroxy bicalutamide is 0.
How many defined atom stereocenter counts does Deshydroxy bicalutamide have?
Deshydroxy bicalutamide has 0 defined atom stereocenter counts.