The synonyms for the compound are 905971-68-8, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-6-benzofuranol 6-acetate, and 6-Acetoxybenzofuran-3-boronic acid pinacol ester.
When was the compound created and modified?
The compound was created on August 19, 2012, and last modified on December 30, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-6-yl] acetate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C16H19BO5/c1-10(18)20-11-6-7-12-13(9-19-14(12)8-11)17-21-15(2,3)16(4,5)22-17/h6-9H,1-5H3.
What is the InChIKey of the compound?
The InChIKey of the compound is SNAVZLVPNUDALH-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=COC3=C2C=CC(=C3)OC(=O)C.
What is the molecular weight of the compound?
The molecular weight of the compound is 302.1 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many heavy atoms does the compound have?
The compound has 22 heavy atoms.
※ Please kindly note that our products are for research use only.
Download
![2-{2-Chloro-6-hydroxy-5-[2-methylquinolin-8-ylaminomethyl]-3-oxo-3H-xanthen-9-yl}benzoic acid](https://resource.alfa-chemistry.com/structure/905982-78-7.gif)
