What is the molecular formula of butyryl-2,2-d2 chloride?
The molecular formula of butyryl-2,2-d2 chloride is C4H7ClO.
What is the molecular weight of butyryl-2,2-d2 chloride?
The molecular weight of butyryl-2,2-d2 chloride is 108.56 g/mol.
When was butyryl-2,2-d2 chloride created?
Butyryl-2,2-d2 chloride was created on February 13, 2015.
When was butyryl-2,2-d2 chloride last modified?
Butyryl-2,2-d2 chloride was last modified on December 30, 2023.
What is the IUPAC name of butyryl-2,2-d2 chloride?
The IUPAC name of butyryl-2,2-d2 chloride is 2,2-dideuteriobutanoyl chloride.
What is the InChI of butyryl-2,2-d2 chloride?
The InChI of butyryl-2,2-d2 chloride is "InChI=1S/C4H7ClO/c1-2-3-4(5)6/h2-3H2,1H3/i3D2".
What is the InChIKey of butyryl-2,2-d2 chloride?
The InChIKey of butyryl-2,2-d2 chloride is "DVECBJCOGJRVPX-SMZGMGDZSA-N".
What is the canonical SMILES of butyryl-2,2-d2 chloride?
The canonical SMILES of butyryl-2,2-d2 chloride is "CCCC(=O)Cl".
What is the XLogP3-AA value of butyryl-2,2-d2 chloride?
The XLogP3-AA value of butyryl-2,2-d2 chloride is 1.6.
How many hydrogen bond acceptors does butyryl-2,2-d2 chloride have?
Butyryl-2,2-d2 chloride has 1 hydrogen bond acceptor.