What is the PubChem CID of 3,3-Diethylthiacarbocyanine iodide?
The PubChem CID of 3,3-Diethylthiacarbocyanine iodide is 5709759.
What is the molecular formula of 3,3-Diethylthiacarbocyanine iodide?
The molecular formula of 3,3-Diethylthiacarbocyanine iodide is C21H21IN2S2.
What is the molecular weight of 3,3-Diethylthiacarbocyanine iodide?
The molecular weight of 3,3-Diethylthiacarbocyanine iodide is 492.4 g/mol.
What is the IUPAC name of 3,3-Diethylthiacarbocyanine iodide?
The IUPAC name of 3,3-Diethylthiacarbocyanine iodide is (2Z)-3-ethyl-2-[(E)-3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole;iodide.
What is the InChI of 3,3-Diethylthiacarbocyanine iodide?
The InChI of 3,3-Diethylthiacarbocyanine iodide is InChI=1S/C21H21N2S2.HI/c1-3-22-16-10-5-7-12-18(16)24-20(22)14-9-15-21-23(4-2)17-11-6-8-13-19(17)25-21;/h5-15H,3-4H2,1-2H3;1H/q+1;/p-1.
What is the InChIKey of 3,3-Diethylthiacarbocyanine iodide?
The InChIKey of 3,3-Diethylthiacarbocyanine iodide is VZBILKJHDPEENF-UHFFFAOYSA-M.
What is the canonical SMILES of 3,3-Diethylthiacarbocyanine iodide?
The canonical SMILES of 3,3-Diethylthiacarbocyanine iodide is CCN1C2=CC=CC=C2SC1=CC=CC3=[N+](C4=CC=CC=C4S3)CC.[I-].
What is the CAS number of 3,3-Diethylthiacarbocyanine iodide?
The CAS number of 3,3-Diethylthiacarbocyanine iodide is 905-97-5.
What is the European Community (EC) Number of 3,3-Diethylthiacarbocyanine iodide?
The European Community (EC) Number of 3,3-Diethylthiacarbocyanine iodide is 620-696-5.
What is the topological polar surface area of 3,3-Diethylthiacarbocyanine iodide?
The topological polar surface area of 3,3-Diethylthiacarbocyanine iodide is 60.7Ų.
※ Please kindly note that our products are for research use only.