What is the molecular formula of 3-Phenylmethanesulfonyl-propionic acid?
Molecular formula of 3-Phenylmethanesulfonyl-propionic acid is C10H12O4S.
What is the molecular weight of 3-Phenylmethanesulfonyl-propionic acid?
The molecular weight of 3-Phenylmethanesulfonyl-propionic acid is 228.27 g/mol.
What are some synonyms of 3-Phenylmethanesulfonyl-propionic acid?
Some synonyms of 3-Phenylmethanesulfonyl-propionic acid are 3-(benzylsulfonyl)propanoic acid, 3-benzylsulfonylpropanoic acid, and 3-phenylmethanesulfonylpropanoic acid.
When was 3-Phenylmethanesulfonyl-propionic acid created and last modified?
3-Phenylmethanesulfonyl-propionic acid was created on 2005-08-10 and last modified on 2023-12-30.
What is the IUPAC name of 3-Phenylmethanesulfonyl-propionic acid?
The IUPAC name of 3-Phenylmethanesulfonyl-propionic acid is 3-benzylsulfonylpropanoic acid.
What is the InChI of 3-Phenylmethanesulfonyl-propionic acid?
The InChI of 3-Phenylmethanesulfonyl-propionic acid is InChI=1S/C10H12O4S/c11-10(12)6-7-15(13,14)8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,11,12).
What is the InChIKey of 3-Phenylmethanesulfonyl-propionic acid?
The InChIKey of 3-Phenylmethanesulfonyl-propionic acid is DXVJEQSCVWZYQP-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Phenylmethanesulfonyl-propionic acid?
The canonical SMILES of 3-Phenylmethanesulfonyl-propionic acid is C1=CC=C(C=C1)CS(=O)(=O)CCC(=O)O.
What is the XLogP3-AA value of 3-Phenylmethanesulfonyl-propionic acid?
The XLogP3-AA value of 3-Phenylmethanesulfonyl-propionic acid is 0.6.
What is the topological polar surface area of 3-Phenylmethanesulfonyl-propionic acid?
The topological polar surface area of 3-Phenylmethanesulfonyl-propionic acid is 79.8 Ų.
※ Please kindly note that our products are for research use only.