What is the molecular formula of 2,2,2-Trichloroethoxysulfuryl imidazole?
The molecular formula of 2,2,2-Trichloroethoxysulfuryl imidazole is C5H5Cl3N2O3S.
What are the synonyms of 2,2,2-Trichloroethoxysulfuryl imidazole?
The synonyms of 2,2,2-Trichloroethoxysulfuryl imidazole include 903587-98-4, 2,2,2-trichloroethyl 1H-imidazole-2-sulfonate, starbld0006454, DTXSID60693114, etc.
What is the molecular weight of 2,2,2-Trichloroethoxysulfuryl imidazole?
The molecular weight of 2,2,2-Trichloroethoxysulfuryl imidazole is 279.5 g/mol.
When was 2,2,2-Trichloroethoxysulfuryl imidazole created?
2,2,2-Trichloroethoxysulfuryl imidazole was created on July 20, 2011.
When was 2,2,2-Trichloroethoxysulfuryl imidazole last modified?
2,2,2-Trichloroethoxysulfuryl imidazole was last modified on December 30, 2023.
What is the IUPAC name of 2,2,2-Trichloroethoxysulfuryl imidazole?
The IUPAC name of 2,2,2-Trichloroethoxysulfuryl imidazole is 2,2,2-trichloroethyl 1H-imidazole-2-sulfonate.
What is the InChI of 2,2,2-Trichloroethoxysulfuryl imidazole?
The InChI of 2,2,2-Trichloroethoxysulfuryl imidazole is InChI=1S/C5H5Cl3N2O3S/c6-5(7,8)3-13-14(11,12)4-9-1-2-10-4/h1-2H,3H2,(H,9,10).
What is the InChIKey of 2,2,2-Trichloroethoxysulfuryl imidazole?
The InChIKey of 2,2,2-Trichloroethoxysulfuryl imidazole is DCLRQEGHGBFLAQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,2,2-Trichloroethoxysulfuryl imidazole?
The canonical SMILES of 2,2,2-Trichloroethoxysulfuryl imidazole is C1=CN=C(N1)S(=O)(=O)OCC(Cl)(Cl)Cl.
What is the CAS number of 2,2,2-Trichloroethoxysulfuryl imidazole?
The CAS number of 2,2,2-Trichloroethoxysulfuryl imidazole is 903587-98-4.