What is the molecular formula of D-Mannitol-1,1-c-t2(9ci)?
The molecular formula of D-Mannitol-1,1-c-t2(9ci) is C6H14O6.
What is the molecular weight of D-Mannitol-1,1-c-t2(9ci)?
The molecular weight of D-Mannitol-1,1-c-t2(9ci) is 186.19 g/mol.
When was D-Mannitol-1,1-c-t2(9ci) created?
D-Mannitol-1,1-c-t2(9ci) was created on May 17, 2013.
When was D-Mannitol-1,1-c-t2(9ci) last modified?
D-Mannitol-1,1-c-t2(9ci) was last modified on December 30, 2023.
What is the IUPAC name of D-Mannitol-1,1-c-t2(9ci)?
The IUPAC name of D-Mannitol-1,1-c-t2(9ci) is (2R,3R,4R,5R)-1,1-ditritiohexane-1,2,3,4,5,6-hexol.
What is the InChI of D-Mannitol-1,1-c-t2(9ci)?
The InChI of D-Mannitol-1,1-c-t2(9ci) is InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6-/m1/s1/i1T2.
What is the InChIKey of D-Mannitol-1,1-c-t2(9ci)?
The InChIKey of D-Mannitol-1,1-c-t2(9ci) is FBPFZTCFMRRESA-KOIQRLOXSA-N.
What is the canonical SMILES of D-Mannitol-1,1-c-t2(9ci)?
The canonical SMILES of D-Mannitol-1,1-c-t2(9ci) is C(C(C(C(C(CO)O)O)O)O)O.
What is the molecular weight of D-Mannitol-1,1-c-t2(9ci) according to PubChem?
The molecular weight of D-Mannitol-1,1-c-t2(9ci) according to PubChem is 186.19 g/mol.
What is the Monoisotopic Mass of D-Mannitol-1,1-c-t2(9ci)?
The Monoisotopic Mass of D-Mannitol-1,1-c-t2(9ci) is 186.09548666 g/mol.