What is the PubChem CID of Rac-trans jasmonic acid?
The PubChem CID of Rac-trans jasmonic acid is 5367720.
What is the molecular formula of Rac-trans jasmonic acid?
The molecular formula of Rac-trans jasmonic acid is C12H18O3.
What are the synonyms of Rac-trans jasmonic acid?
The synonyms of Rac-trans jasmonic acid include 3572-66-5, (+/-)-Jasmonic acid, rac-trans Jasmonic Acid, 2-[3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]acetic acid, and 3-(Carboxymethyl)-2-(2-pentenyl)cyclopentanone.
What is the molecular weight of Rac-trans jasmonic acid?
The molecular weight of Rac-trans jasmonic acid is 210.27 g/mol.
What is the IUPAC name of Rac-trans jasmonic acid?
The IUPAC name of Rac-trans jasmonic acid is 2-[3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]acetic acid.
What is the InChI of Rac-trans jasmonic acid?
The InChI of Rac-trans jasmonic acid is InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3+.
What is the InChIKey of Rac-trans jasmonic acid?
The InChIKey of Rac-trans jasmonic acid is ZNJFBWYDHIGLCU-ONEGZZNKSA-N.
What is the canonical SMILES of Rac-trans jasmonic acid?
The canonical SMILES of Rac-trans jasmonic acid is CCC=CCC1C(CCC1=O)CC(=O)O.
What is the isomeric SMILES of Rac-trans jasmonic acid?
The isomeric SMILES of Rac-trans jasmonic acid is CC/C=C/CC1C(CCC1=O)CC(=O)O.
Is Rac-trans jasmonic acid a canonicalized compound?
Yes, Rac-trans jasmonic acid is a canonicalized compound.