What is the molecular formula of Boc-L-ala-L-ala?
The molecular formula of Boc-L-ala-L-ala is C11H22N2O6.
What are the synonyms of Boc-L-ala-L-ala?
The synonyms of Boc-L-ala-L-ala are Boc-Ala-Ala-OH.H2O and 90303-36-9 (tert-Butoxycarbonyl)-L-alanyl-L-alanine monohydrate.
What is the molecular weight of Boc-L-ala-L-ala?
The molecular weight of Boc-L-ala-L-ala is 278.30 g/mol.
What is the parent compound of Boc-L-ala-L-ala?
The parent compound of Boc-L-ala-L-ala is CID 6992569 (Boc-ala-ala-OH).
What are the component compounds of Boc-L-ala-L-ala?
The component compounds of Boc-L-ala-L-ala are water (CID 962) and Boc-ala-ala-OH (CID 6992569).
What is the IUPAC name of Boc-L-ala-L-ala?
The IUPAC name of Boc-L-ala-L-ala is (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid;hydrate.
What is the InChI of Boc-L-ala-L-ala?
The InChI of Boc-L-ala-L-ala is InChI=1S/C11H20N2O5.H2O/c1-6(8(14)12-7(2)9(15)16)13-10(17)18-11(3,4)5;/h6-7H,1-5H3,(H,12,14)(H,13,17)(H,15,16);1H2/t6-,7-;/m0./s1.
What is the InChIKey of Boc-L-ala-L-ala?
The InChIKey of Boc-L-ala-L-ala is OIDSMSOXNMHHCH-LEUCUCNGSA-N.
What is the canonical SMILES of Boc-L-ala-L-ala?
The canonical SMILES of Boc-L-ala-L-ala is CC(C(=O)NC(C)C(=O)O)NC(=O)OC(C)(C)C.O.