What is the molecular formula of (Z)-Beta-2,3,4,5,6-hexachlorostyrene?
The molecular formula of (Z)-Beta-2,3,4,5,6-hexachlorostyrene is C8H2Cl6.
What is the molecular weight of (Z)-Beta-2,3,4,5,6-hexachlorostyrene?
The molecular weight of (Z)-Beta-2,3,4,5,6-hexachlorostyrene is 310.8 g/mol.
What is the IUPAC name of (Z)-Beta-2,3,4,5,6-hexachlorostyrene?
The IUPAC name of (Z)-Beta-2,3,4,5,6-hexachlorostyrene is 1,2,3,4,5-pentachloro-6-[(Z)-2-chloroethenyl]benzene.
What is the InChI key of (Z)-Beta-2,3,4,5,6-hexachlorostyrene?
The InChI key of (Z)-Beta-2,3,4,5,6-hexachlorostyrene is FHYTVYKUXNWGBE-UPHRSURJSA-N.
What is the canonical SMILES of (Z)-Beta-2,3,4,5,6-hexachlorostyrene?
The canonical SMILES of (Z)-Beta-2,3,4,5,6-hexachlorostyrene is C(=CCl)C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl.
What is the CAS number of (Z)-Beta-2,3,4,5,6-hexachlorostyrene?
The CAS number of (Z)-Beta-2,3,4,5,6-hexachlorostyrene is 61128-00-5.
What is the XLogP3-AA value of (Z)-Beta-2,3,4,5,6-hexachlorostyrene?
The XLogP3-AA value of (Z)-Beta-2,3,4,5,6-hexachlorostyrene is 6.1.
How many rotatable bonds does (Z)-Beta-2,3,4,5,6-hexachlorostyrene have?
(Z)-Beta-2,3,4,5,6-hexachlorostyrene has 1 rotatable bond.
Is (Z)-Beta-2,3,4,5,6-hexachlorostyrene a canonicalized compound?
Yes, (Z)-Beta-2,3,4,5,6-hexachlorostyrene is a canonicalized compound.