What is the PubChem CID of quinapril?
The PubChem CID of quinapril is 54892.
What is the molecular formula of quinapril?
The molecular formula of quinapril is C25H30N2O5.
What is the molecular weight of quinapril?
The molecular weight of quinapril is 438.5 g/mol.
What is the IUPAC name of quinapril?
The IUPAC name of quinapril is (3S)-2-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
What is the InChI of quinapril?
The InChI of quinapril is InChI=1S/C25H30N2O5/c1-3-32-25(31)21(14-13-18-9-5-4-6-10-18)26-17(2)23(28)27-16-20-12-8-7-11-19(20)15-22(27)24(29)30/h4-12,17,21-22,26H,3,13-16H2,1-2H3,(H,29,30)/t17-,21-,22-/m0/s1.
What is the InChIKey of quinapril?
The InChIKey of quinapril is JSDRRTOADPPCHY-HSQYWUDLSA-N.
What is the canonical SMILES of quinapril?
The canonical SMILES of quinapril is CCOC(=O)C(CCC1=CC=CC=C1)NC(C)C(=O)N2CC3=CC=CC=C3CC2C(=O)O.
What is the common synonym for quinapril?
The common synonym for quinapril is Quinaprilum.
What is the pharmacological class of quinapril?
The pharmacological class of quinapril is an angiotensin-converting enzyme inhibitor (ACE inhibitor).
When was quinapril granted FDA approval?
Quinapril was granted FDA approval on November 19, 1991.
Download
![[1Alpha(E),3beta]-4-(2,2,3-trimethyl-6-methylenecyclohexyl)but-3-en-2-one](https://resource.alfa-chemistry.com/structure/90242-86-7.gif)
