What is the molecular formula of 1,2-Indandiol?
The molecular formula of 1,2-Indandiol is C9H10O2.
What is the molecular weight of 1,2-Indandiol?
The molecular weight of 1,2-Indandiol is 150.17 g/mol.
What is the IUPAC name of 1,2-Indandiol?
The IUPAC name of 1,2-Indandiol is 2,3-dihydro-1H-indene-1,2-diol.
What is the InChI of 1,2-Indandiol?
The InChI of 1,2-Indandiol is InChI=1S/C9H10O2/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-11H,5H2.
What is the InChIKey of 1,2-Indandiol?
The InChIKey of 1,2-Indandiol is YKXXBEOXRPZVCC-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2-Indandiol?
The canonical SMILES of 1,2-Indandiol is C1C(C(C2=CC=CC=C21)O)O.
What is the CAS number of 1,2-Indandiol?
The CAS number of 1,2-Indandiol is 46447-43-2.
What is the European Community (EC) number of 1,2-Indandiol?
The European Community (EC) number of 1,2-Indandiol is 680-193-1.
What is the XLogP3-AA value of 1,2-Indandiol?
The XLogP3-AA value of 1,2-Indandiol is 0.5.
Is 1,2-Indandiol a canonicalized compound?
Yes, 1,2-Indandiol is a canonicalized compound.