What is the molecular formula of Adiphenine HCl?
The molecular formula of Adiphenine HCl is C20H26ClNO2.
What is the molecular weight of Adiphenine HCl?
The molecular weight of Adiphenine HCl is 347.9 g/mol.
What is the IUPAC Name of Adiphenine HCl?
The IUPAC Name of Adiphenine HCl is 2-(diethylamino)ethyl 2,2-diphenylacetate; hydrochloride.
What is the InChIKey of Adiphenine HCl?
The InChIKey of Adiphenine HCl is LKPINBXAWIMZCG-UHFFFAOYSA-N.
What is the Canonical SMILES of Adiphenine HCl?
The Canonical SMILES of Adiphenine HCl is CCN(CC)CCOC(=O)C(C1=CC=CC=C1)C2=CC=CC=C2.Cl.
What is the CAS number of Adiphenine HCl?
The CAS number of Adiphenine HCl is 50-42-0.
What is the European Community (EC) Number of Adiphenine HCl?
The European Community (EC) Number of Adiphenine HCl is 200-036-9.
What is the UNII of Adiphenine HCl?
The UNII of Adiphenine HCl is 42B4PDY0AV.
What is the ChEMBL ID of Adiphenine HCl?
The ChEMBL ID of Adiphenine HCl is CHEMBL555654.
What is the NCI Thesaurus Code of Adiphenine HCl?
The NCI Thesaurus Code of Adiphenine HCl is C75271.