The molecular formula of the compound is C16H24ClNO4.
What are the synonyms of the compound?
Some synonyms of the compound are 90159-60-7, (R)-5-Benzyl 1-tert-butyl 2-aminopentanedioate hydrochloride, H-D-GLU(OBZL)-OTBU HCL, and more.
What is the molecular weight of the compound?
The molecular weight of the compound is 329.82 g/mol.
What is the parent compound of the compound?
The parent compound of the compound is CID 15736106 (5-benzyl 1-tert-butyl (2R)-2-aminopentanedioate).
What are the component compounds of the compound?
The component compounds of the compound are CID 15736106 (5-benzyl 1-tert-butyl (2R)-2-aminopentanedioate) and CID 313 (Hydrochloric Acid).
When was the compound created?
The compound was created on March 8, 2012.
When was the compound modified?
The compound was last modified on December 30, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate;hydrochloride.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C16H23NO4.ClH/c1-16(2,3)21-15(19)13(17)9-10-14(18)20-11-12-7-5-4-6-8-12;/h4-8,13H,9-11,17H2,1-3H3;1H/t13-;/m1./s1.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CC(C)(C)OC(=O)C(CCC(=O)OCC1=CC=CC=C1)N.Cl.
※ Please kindly note that our products are for research use only.