What is the PubChem CID for cilazaprilat?
The PubChem CID for cilazaprilat is 64766.
What is the molecular formula of cilazaprilat?
The molecular formula of cilazaprilat is C20H27N3O5.
What is the molecular weight of cilazaprilat?
The molecular weight of cilazaprilat is 389.4 g/mol.
What is the IUPAC name of cilazaprilat?
The IUPAC name of cilazaprilat is (4S,7S)-7-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylic acid.
What is the InChI of cilazaprilat?
The InChI of cilazaprilat is InChI=1S/C20H27N3O5/c24-18-15(8-4-12-22-13-5-9-17(20(27)28)23(18)22)21-16(19(25)26)11-10-14-6-2-1-3-7-14/h1-3,6-7,15-17,21H,4-5,8-13H2,(H,25,26)(H,27,28)/t15-,16-,17-/m0/s1.
What is the canonical SMILES of cilazaprilat?
The canonical SMILES of cilazaprilat is C1CC(C(=O)N2C(CCCN2C1)C(=O)O)NC(CCC3=CC=CC=C3)C(=O)O.
What is the CAS number of cilazaprilat?
The CAS number of cilazaprilat is 90139-06-3.
What is the UNII code of cilazaprilat?
The UNII code of cilazaprilat is WBL76FH528.
What is the ChEMBL ID of cilazaprilat?
The ChEMBL ID of cilazaprilat is CHEMBL2104578.
What is the NCI Thesaurus Code of cilazaprilat?
The NCI Thesaurus Code of cilazaprilat is C75927.