What is the molecular formula of Flamprop-M?
The molecular formula of Flamprop-M is C16H13ClFNO3.
What is the molecular weight of Flamprop-M?
The molecular weight of Flamprop-M is 321.73 g/mol.
What is the IUPAC name of Flamprop-M?
The IUPAC name of Flamprop-M is (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)propanoic acid.
What is the InChI of Flamprop-M?
The InChI of Flamprop-M is InChI=1S/C16H13ClFNO3/c1-10(16(21)22)19(12-7-8-14(18)13(17)9-12)15(20)11-5-3-2-4-6-11/h2-10H,1H3,(H,21,22)/t10-/m1/s1.
What is the InChIKey of Flamprop-M?
The InChIKey of Flamprop-M is YQVMVCCFZCMYQB-SNVBAGLBSA-N.
What are the synonyms of Flamprop-M?
The synonyms of Flamprop-M are Flamprop-M, Flamprop M, 90134-59-1, (R)-Flamprop, Flamprop-M [BSI:ISO], and more.
What is the CAS number of Flamprop-M?
The CAS number of Flamprop-M is 90134-59-1.
What is the European Community (EC) number of Flamprop-M?
The European Community (EC) number of Flamprop-M is 618-483-7.
What is the UNII of Flamprop-M?
The UNII of Flamprop-M is WS678504GY.
What is the XLogP3 value of Flamprop-M?
The XLogP3 value of Flamprop-M is 2.9.